C16H15ClO3S — CID 91880247
1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylethanone (PubChem CID 91880247) has the molecular formula C16H15ClO3S and a molecular weight of 322.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylethanone.
| Compound Name | 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 91880247 |
| Molecular Formula | C16H15ClO3S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-(2-chlorophenyl)-2-(3,4-dimethoxyphenyl)sulfanylethanone |
| SMILES | COc1ccc(SCC(=O)c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C16H15ClO3S/c1-19-15-8-7-11(9-16(15)20-2)21-10-14(18)12-5-3-4-6-13(12)17/h3-9H,10H2,1-2H3 |
| InChIKey | QBSHQLATSVIYMV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |