C16H15FO3S — CID 91880258
2-(3,4-dimethoxyphenyl)sulfanyl-1-(3-fluorophenyl)ethanone (PubChem CID 91880258) has the molecular formula C16H15FO3S and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-1-(3-fluorophenyl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 91880258 |
| Molecular Formula | C16H15FO3S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-(3-fluorophenyl)ethanone |
| SMILES | COc1ccc(SCC(=O)c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C16H15FO3S/c1-19-15-7-6-13(9-16(15)20-2)21-10-14(18)11-4-3-5-12(17)8-11/h3-9H,10H2,1-2H3 |
| InChIKey | WNWVQXOQVTXIDV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |