C16H15NO5S — CID 91880270
2-(3,4-dimethoxyphenyl)sulfanyl-1-(4-nitrophenyl)ethanone (PubChem CID 91880270) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 91880270 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-(4-nitrophenyl)ethanone |
| SMILES | COc1ccc(SCC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C16H15NO5S/c1-21-15-8-7-13(9-16(15)22-2)23-10-14(18)11-3-5-12(6-4-11)17(19)20/h3-9H,10H2,1-2H3 |
| InChIKey | QRQUAGQVBUGAHJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|