C14H11NO5S — CID 43801511
1-(3,4-dihydroxyphenyl)-2-(4-nitrophenyl)sulfanylethanone (PubChem CID 43801511) has the molecular formula C14H11NO5S and a molecular weight of 305.31 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(4-nitrophenyl)sulfanylethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(4-nitrophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 43801511 |
| Molecular Formula | C14H11NO5S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(4-nitrophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H11NO5S/c16-12-6-1-9(7-13(12)17)14(18)8-21-11-4-2-10(3-5-11)15(19)20/h1-7,16-17H,8H2 |
| InChIKey | VRPPMIJBXGZPHI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|