C21H14Cl2N2O4S — CID 23095508
N-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 23095508) has the molecular formula C21H14Cl2N2O4S and a molecular weight of 461.33 g/mol. Its IUPAC name is N-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 23095508 |
| Molecular Formula | C21H14Cl2N2O4S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | N-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2N2O4S/c22-18-9-4-13(11-19(18)23)20(26)12-30-17-7-5-15(6-8-17)24-21(27)14-2-1-3-16(10-14)25(28)29/h1-11H,12H2,(H,24,27) |
| InChIKey | NETVPRHJHVCTMY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|