C18H18O5S — CID 91880265
2-[3-[2-(3,4-dimethoxyphenyl)sulfanylacetyl]phenyl]acetic acid (PubChem CID 91880265) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[3-[2-(3,4-dimethoxyphenyl)sulfanylacetyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-(3,4-dimethoxyphenyl)sulfanylacetyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 91880265 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[3-[2-(3,4-dimethoxyphenyl)sulfanylacetyl]phenyl]acetic acid |
| SMILES | COc1ccc(SCC(=O)c2cccc(CC(=O)O)c2)cc1OC |
| InChI | InChI=1S/C18H18O5S/c1-22-16-7-6-14(10-17(16)23-2)24-11-15(19)13-5-3-4-12(8-13)9-18(20)21/h3-8,10H,9,11H2,1-2H3,(H,20,21) |
| InChIKey | VUUURELMQAOHRP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |