C14H11Cl2NOS — CID 963352
N-(2,6-dichlorophenyl)-2-phenylsulfanylacetamide (PubChem CID 963352) has the molecular formula C14H11Cl2NOS and a molecular weight of 312.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-phenylsulfanylacetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 963352 |
| Molecular Formula | C14H11Cl2NOS |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NOS/c15-11-7-4-8-12(16)14(11)17-13(18)9-19-10-5-2-1-3-6-10/h1-8H,9H2,(H,17,18) |
| InChIKey | SITPOTAWJJRUSC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |