C15H12Cl3NOS — CID 60594383
2-(3-methylphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 60594383) has the molecular formula C15H12Cl3NOS and a molecular weight of 360.69 g/mol. Its IUPAC name is 2-(3-methylphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(3-methylphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 60594383 |
| Molecular Formula | C15H12Cl3NOS |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 2-(3-methylphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | Cc1cccc(SCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl3NOS/c1-9-3-2-4-11(5-9)21-8-14(20)19-15-12(17)6-10(16)7-13(15)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | ZNHGEXOICRQRDZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |