C14H10Cl3NO2S — CID 62000709
2-(2-hydroxyphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 62000709) has the molecular formula C14H10Cl3NO2S and a molecular weight of 362.67 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(2-hydroxyphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 62000709 |
| Molecular Formula | C14H10Cl3NO2S |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 2-(2-hydroxyphenyl)sulfanyl-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1ccccc1O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3NO2S/c15-8-5-9(16)14(10(17)6-8)18-13(20)7-21-12-4-2-1-3-11(12)19/h1-6,19H,7H2,(H,18,20) |
| InChIKey | KXGULTKRMNOTJD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |