C9H9Cl3N4OS — CID 77061134
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] N'-aminocarbamimidothioate (PubChem CID 77061134) has the molecular formula C9H9Cl3N4OS and a molecular weight of 327.62 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77061134 |
| Molecular Formula | C9H9Cl3N4OS |
| Molecular Weight | 327.62 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N4OS/c10-4-1-5(11)8(6(12)2-4)15-7(17)3-18-9(13)16-14/h1-2H,3,14H2,(H2,13,16)(H,15,17) |
| InChIKey | KCGHMHYIWXHNRU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|