C12H12Cl3NO3S — CID 105352761
2-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanylbutanoic acid (PubChem CID 105352761) has the molecular formula C12H12Cl3NO3S and a molecular weight of 356.66 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanylbutanoic acid.
| Compound Name | 2-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 105352761 |
| Molecular Formula | C12H12Cl3NO3S |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 2-[2-oxo-2-(2,4,6-trichloroanilino)ethyl]sulfanylbutanoic acid |
| SMILES | CCC(SCC(=O)Nc1c(Cl)cc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H12Cl3NO3S/c1-2-9(12(18)19)20-5-10(17)16-11-7(14)3-6(13)4-8(11)15/h3-4,9H,2,5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XPGNIXWZXNBDIO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |