C12H15Cl3N2O — CID 60646938
2-(butan-2-ylamino)-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 60646938) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(butan-2-ylamino)-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 60646938 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-(butan-2-ylamino)-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | CCC(C)NCC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl3N2O/c1-3-7(2)16-6-11(18)17-12-9(14)4-8(13)5-10(12)15/h4-5,7,16H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | YLONEYRMJBULMO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |