C12H15Cl2NO — CID 82101529
2-(butan-2-ylamino)-1-(2,4-dichlorophenyl)ethanone (PubChem CID 82101529) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-(butan-2-ylamino)-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 82101529 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(butan-2-ylamino)-1-(2,4-dichlorophenyl)ethanone |
| SMILES | CCC(C)NCC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c1-3-8(2)15-7-12(16)10-5-4-9(13)6-11(10)14/h4-6,8,15H,3,7H2,1-2H3 |
| InChIKey | WVSKYFHNEGILDE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |