C11H11Cl2NO3S — CID 140569269
2-[[2-(2,4-dichlorophenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid (PubChem CID 140569269) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-(2,4-dichlorophenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 140569269 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(CNC(CS)C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3S/c12-6-1-2-7(8(13)3-6)10(15)4-14-9(5-18)11(16)17/h1-3,9,14,18H,4-5H2,(H,16,17) |
| InChIKey | QXEUXEOLTLVIIB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|