C10H8Cl5NO — CID 796782
(3R)-3-amino-4,4,4-trichloro-1-(2,4-dichlorophenyl)butan-1-one (PubChem CID 796782) has the molecular formula C10H8Cl5NO and a molecular weight of 335.45 g/mol. Its IUPAC name is (3R)-3-amino-4,4,4-trichloro-1-(2,4-dichlorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-4,4,4-trichloro-1-(2,4-dichlorophenyl)butan-1-one |
|---|---|
| PubChem CID | 796782 |
| Molecular Formula | C10H8Cl5NO |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | (3R)-3-amino-4,4,4-trichloro-1-(2,4-dichlorophenyl)butan-1-one |
| SMILES | N[C@H](CC(=O)c1ccc(Cl)cc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H8Cl5NO/c11-5-1-2-6(7(12)3-5)8(17)4-9(16)10(13,14)15/h1-3,9H,4,16H2/t9-/m1/s1 |
| InChIKey | XKORDZUSKUKORP-SECBINFHSA-N |
| XLogP | 4.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|