C14H17Cl2NO3 — CID 83226474
tert-butyl 2-amino-4-(2,5-dichlorophenyl)-4-oxobutanoate (PubChem CID 83226474) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is tert-butyl 2-amino-4-(2,5-dichlorophenyl)-4-oxobutanoate.
| Compound Name | tert-butyl 2-amino-4-(2,5-dichlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 83226474 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | tert-butyl 2-amino-4-(2,5-dichlorophenyl)-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(N)CC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H17Cl2NO3/c1-14(2,3)20-13(19)11(17)7-12(18)9-6-8(15)4-5-10(9)16/h4-6,11H,7,17H2,1-3H3 |
| InChIKey | CYTLYVGLDGAGKB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |