C19H30ClN3O4 — CID 145273558
tert-butyl 2-[[2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoyl]amino]acetate;propane (PubChem CID 145273558) has the molecular formula C19H30ClN3O4 and a molecular weight of 399.92 g/mol. Its IUPAC name is tert-butyl 2-[[2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoyl]amino]acetate;propane.
| Compound Name | tert-butyl 2-[[2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoyl]amino]acetate;propane |
|---|---|
| PubChem CID | 145273558 |
| Molecular Formula | C19H30ClN3O4 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl 2-[[2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoyl]amino]acetate;propane |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C(N)CC(=O)c1ccc(Cl)cc1N.CCC |
| InChI | InChI=1S/C16H22ClN3O4.C3H8/c1-16(2,3)24-14(22)8-20-15(23)12(19)7-13(21)10-5-4-9(17)6-11(10)18;1-3-2/h4-6,12H,7-8,18-19H2,1-3H3,(H,20,23);3H2,1-2H3 |
| InChIKey | UUOADLITSRDVSE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|