C13H17ClN2O3 — CID 126673392
propyl 2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoate (PubChem CID 126673392) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is propyl 2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoate.
| Compound Name | propyl 2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 126673392 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | propyl 2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoate |
| SMILES | CCCOC(=O)C(N)CC(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C13H17ClN2O3/c1-2-5-19-13(18)11(16)7-12(17)9-4-3-8(14)6-10(9)15/h3-4,6,11H,2,5,7,15-16H2,1H3 |
| InChIKey | BEIBSAPGGPWVMD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|