C12H15ClN2O3 — CID 8602840
[(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-amino-4-chlorobenzoate (PubChem CID 8602840) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-amino-4-chlorobenzoate.
| Compound Name | [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 8602840 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [(2S)-1-(ethylamino)-1-oxopropan-2-yl] 2-amino-4-chlorobenzoate |
| SMILES | CCNC(=O)[C@H](C)OC(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C12H15ClN2O3/c1-3-15-11(16)7(2)18-12(17)9-5-4-8(13)6-10(9)14/h4-7H,3,14H2,1-2H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | LBNLVEUKVIOLSP-ZETCQYMHSA-N |
| XLogP | 1.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|