C11H12ClN3O4 — CID 60626647
[1-(carbamoylamino)-1-oxopropan-2-yl] 2-amino-5-chlorobenzoate (PubChem CID 60626647) has the molecular formula C11H12ClN3O4 and a molecular weight of 285.69 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 2-amino-5-chlorobenzoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 60626647 |
| Molecular Formula | C11H12ClN3O4 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-amino-5-chlorobenzoate |
| SMILES | CC(OC(=O)c1cc(Cl)ccc1N)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H12ClN3O4/c1-5(9(16)15-11(14)18)19-10(17)7-4-6(12)2-3-8(7)13/h2-5H,13H2,1H3,(H3,14,15,16,18) |
| InChIKey | LEIJLNWYRJSAIO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|