C24H30ClN3O4 — CID 126694551
tert-butyl (2S)-2-[[3-amino-5-(2-amino-4-chlorophenyl)-5-oxopent-1-en-2-yl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 126694551) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-amino-5-(2-amino-4-chlorophenyl)-5-oxopent-1-en-2-yl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-[[3-amino-5-(2-amino-4-chlorophenyl)-5-oxopent-1-en-2-yl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 126694551 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | tert-butyl (2S)-2-[[3-amino-5-(2-amino-4-chlorophenyl)-5-oxopent-1-en-2-yl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | C=C(N[C@@H](Cc1ccc(O)cc1)C(=O)OC(C)(C)C)C(N)CC(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C24H30ClN3O4/c1-14(19(26)13-22(30)18-10-7-16(25)12-20(18)27)28-21(23(31)32-24(2,3)4)11-15-5-8-17(29)9-6-15/h5-10,12,19,21,28-29H,1,11,13,26-27H2,2-4H3/t19?,21-/m0/s1 |
| InChIKey | BTVICXAYYYELIO-QWAKEFERSA-N |
| XLogP | 3.58 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|