C12H16ClNO3S — CID 83226237
tert-butyl 2-amino-4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 83226237) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is tert-butyl 2-amino-4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | tert-butyl 2-amino-4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 83226237 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | tert-butyl 2-amino-4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(N)CC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H16ClNO3S/c1-12(2,3)17-11(16)7(14)6-8(15)9-4-5-10(13)18-9/h4-5,7H,6,14H2,1-3H3 |
| InChIKey | FTKQNQAUKOBMSY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |