C16H23NO4 — CID 83224632
tert-butyl 2-amino-4-(2-methoxy-4-methylphenyl)-4-oxobutanoate (PubChem CID 83224632) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is tert-butyl 2-amino-4-(2-methoxy-4-methylphenyl)-4-oxobutanoate.
| Compound Name | tert-butyl 2-amino-4-(2-methoxy-4-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 83224632 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | tert-butyl 2-amino-4-(2-methoxy-4-methylphenyl)-4-oxobutanoate |
| SMILES | COc1cc(C)ccc1C(=O)CC(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO4/c1-10-6-7-11(14(8-10)20-5)13(18)9-12(17)15(19)21-16(2,3)4/h6-8,12H,9,17H2,1-5H3 |
| InChIKey | MVZYZMDTIHUKBO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |