C12H10Cl5NO2 — CID 1067754
N-[(2R)-1,1,1-trichloro-4-(2,4-dichlorophenyl)-4-oxobutan-2-yl]acetamide (PubChem CID 1067754) has the molecular formula C12H10Cl5NO2 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[(2R)-1,1,1-trichloro-4-(2,4-dichlorophenyl)-4-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2R)-1,1,1-trichloro-4-(2,4-dichlorophenyl)-4-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 1067754 |
| Molecular Formula | C12H10Cl5NO2 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | N-[(2R)-1,1,1-trichloro-4-(2,4-dichlorophenyl)-4-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](CC(=O)c1ccc(Cl)cc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H10Cl5NO2/c1-6(19)18-11(12(15,16)17)5-10(20)8-3-2-7(13)4-9(8)14/h2-4,11H,5H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | WJTLHDXSWHHQMX-LLVKDONJSA-N |
| XLogP | 4.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|