C10H9Cl4NO — CID 67575764
N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]acetamide (PubChem CID 67575764) has the molecular formula C10H9Cl4NO and a molecular weight of 301.00 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]acetamide.
| Compound Name | N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 67575764 |
| Molecular Formula | C10H9Cl4NO |
| Molecular Weight | 301.00 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | N-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]acetamide |
| SMILES | CC(=O)NC(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl4NO/c1-6(16)15-9(10(12,13)14)7-2-4-8(11)5-3-7/h2-5,9H,1H3,(H,15,16) |
| InChIKey | XQIKZBLETSELJO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.00 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|