C19H21Cl2N3O2S — CID 44572575
N-[(2R)-1-[[(2R)-2-amino-3-phenylpropyl]amino]-1-oxo-3-sulfanylpropan-2-yl]-2,4-dichlorobenzamide (PubChem CID 44572575) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is N-[(2R)-1-[[(2R)-2-amino-3-phenylpropyl]amino]-1-oxo-3-sulfanylpropan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[(2R)-1-[[(2R)-2-amino-3-phenylpropyl]amino]-1-oxo-3-sulfanylpropan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 44572575 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-[(2R)-1-[[(2R)-2-amino-3-phenylpropyl]amino]-1-oxo-3-sulfanylpropan-2-yl]-2,4-dichlorobenzamide |
| SMILES | N[C@@H](CNC(=O)[C@H](CS)NC(=O)c1ccc(Cl)cc1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C19H21Cl2N3O2S/c20-13-6-7-15(16(21)9-13)18(25)24-17(11-27)19(26)23-10-14(22)8-12-4-2-1-3-5-12/h1-7,9,14,17,27H,8,10-11,22H2,(H,23,26)(H,24,25)/t14-,17+/m1/s1 |
| InChIKey | ZYZSOJHQXNSILJ-PBHICJAKSA-N |
| XLogP | 2.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|