C11H13NO4S — CID 87372879
(2S)-2-[[2-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid (PubChem CID 87372879) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is (2S)-2-[[2-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-[[2-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87372879 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (2S)-2-[[2-(2-hydroxyphenyl)-2-oxoethyl]amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(CN[C@H](CS)C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C11H13NO4S/c13-9-4-2-1-3-7(9)10(14)5-12-8(6-17)11(15)16/h1-4,8,12-13,17H,5-6H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | NTURWEQMNZPBOA-MRVPVSSYSA-N |
| XLogP | 0.55 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|