C10H7Cl2NO5 — CID 68576201
2-[(2,4-dichlorobenzoyl)amino]propanedioic acid (PubChem CID 68576201) has the molecular formula C10H7Cl2NO5 and a molecular weight of 292.07 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]propanedioic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]propanedioic acid |
|---|---|
| PubChem CID | 68576201 |
| Molecular Formula | C10H7Cl2NO5 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]propanedioic acid |
| SMILES | O=C(NC(C(=O)O)C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NO5/c11-4-1-2-5(6(12)3-4)8(14)13-7(9(15)16)10(17)18/h1-3,7H,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | NPJHMERHFXBDPA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|