C21H17Cl2NO — CID 99951194
2,4-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzamide (PubChem CID 99951194) has the molecular formula C21H17Cl2NO and a molecular weight of 370.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 99951194 |
| Molecular Formula | C21H17Cl2NO |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2,4-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzamide |
| SMILES | Cc1ccc([C@@H](NC(=O)c2ccc(Cl)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17Cl2NO/c1-14-7-9-16(10-8-14)20(15-5-3-2-4-6-15)24-21(25)18-12-11-17(22)13-19(18)23/h2-13,20H,1H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | JFSANVXQOOBCFI-FQEVSTJZSA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |