C16H15Cl2NO — CID 43915384
2,4-dichloro-N-[1-(4-methylphenyl)ethyl]benzamide (PubChem CID 43915384) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 43915384 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2,4-dichloro-N-[1-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-10-3-5-12(6-4-10)11(2)19-16(20)14-8-7-13(17)9-15(14)18/h3-9,11H,1-2H3,(H,19,20) |
| InChIKey | CMCRSEVXIYKEBE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |