C17H15Cl2N3O — CID 1474183
2,4-dichloro-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]benzamide (PubChem CID 1474183) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 1474183 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2,4-dichloro-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]benzamide |
| SMILES | Cc1ccc2nc([C@@H](C)NC(=O)c3ccc(Cl)cc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C17H15Cl2N3O/c1-9-3-6-14-15(7-9)22-16(21-14)10(2)20-17(23)12-5-4-11(18)8-13(12)19/h3-8,10H,1-2H3,(H,20,23)(H,21,22)/t10-/m1/s1 |
| InChIKey | GTLKMRJULPEDBB-SNVBAGLBSA-N |
| XLogP | 4.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |