C22H18ClN3O — CID 43890007
2-chloro-N-[(6-methyl-1H-benzimidazol-2-yl)-phenylmethyl]benzamide (PubChem CID 43890007) has the molecular formula C22H18ClN3O and a molecular weight of 375.86 g/mol. Its IUPAC name is 2-chloro-N-[(6-methyl-1H-benzimidazol-2-yl)-phenylmethyl]benzamide.
| Compound Name | 2-chloro-N-[(6-methyl-1H-benzimidazol-2-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 43890007 |
| Molecular Formula | C22H18ClN3O |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-chloro-N-[(6-methyl-1H-benzimidazol-2-yl)-phenylmethyl]benzamide |
| SMILES | Cc1ccc2nc(C(NC(=O)c3ccccc3Cl)c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C22H18ClN3O/c1-14-11-12-18-19(13-14)25-21(24-18)20(15-7-3-2-4-8-15)26-22(27)16-9-5-6-10-17(16)23/h2-13,20H,1H3,(H,24,25)(H,26,27) |
| InChIKey | UCZZKZQVKWLWAO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |