C21H15N5O5 — CID 43890144
4-nitro-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide (PubChem CID 43890144) has the molecular formula C21H15N5O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is 4-nitro-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide.
| Compound Name | 4-nitro-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 43890144 |
| Molecular Formula | C21H15N5O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-nitro-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide |
| SMILES | O=C(NC(c1ccccc1)c1nc2ccc([N+](=O)[O-])cc2[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15N5O5/c27-21(14-6-8-15(9-7-14)25(28)29)24-19(13-4-2-1-3-5-13)20-22-17-11-10-16(26(30)31)12-18(17)23-20/h1-12,19H,(H,22,23)(H,24,27) |
| InChIKey | HYCSYDOYBBRLEM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|