C23H21N5O3 — CID 43890167
3-(dimethylamino)-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide (PubChem CID 43890167) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 43890167 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-(dimethylamino)-N-[(6-nitro-1H-benzimidazol-2-yl)-phenylmethyl]benzamide |
| SMILES | CN(C)c1cccc(C(=O)NC(c2ccccc2)c2nc3ccc([N+](=O)[O-])cc3[nH]2)c1 |
| InChI | InChI=1S/C23H21N5O3/c1-27(2)17-10-6-9-16(13-17)23(29)26-21(15-7-4-3-5-8-15)22-24-19-12-11-18(28(30)31)14-20(19)25-22/h3-14,21H,1-2H3,(H,24,25)(H,26,29) |
| InChIKey | RSCGLBHCNULQSY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|