C16H13N5O5 — CID 43890079
2-nitro-N-[1-(6-nitro-1H-benzimidazol-2-yl)ethyl]benzamide (PubChem CID 43890079) has the molecular formula C16H13N5O5 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-nitro-N-[1-(6-nitro-1H-benzimidazol-2-yl)ethyl]benzamide.
| Compound Name | 2-nitro-N-[1-(6-nitro-1H-benzimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 43890079 |
| Molecular Formula | C16H13N5O5 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-nitro-N-[1-(6-nitro-1H-benzimidazol-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1[N+](=O)[O-])c1nc2ccc([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C16H13N5O5/c1-9(17-16(22)11-4-2-3-5-14(11)21(25)26)15-18-12-7-6-10(20(23)24)8-13(12)19-15/h2-9H,1H3,(H,17,22)(H,18,19) |
| InChIKey | JAJXHNVEAWKSSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|