C14H12N4O4 — CID 92519664
N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-5-nitrofuran-2-carboxamide (PubChem CID 92519664) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 92519664 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-5-nitrofuran-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc([N+](=O)[O-])o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H12N4O4/c1-8(13-16-9-4-2-3-5-10(9)17-13)15-14(19)11-6-7-12(22-11)18(20)21/h2-8H,1H3,(H,15,19)(H,16,17)/t8-/m1/s1 |
| InChIKey | DUBGVQBIJDCBHS-MRVPVSSYSA-N |
| XLogP | 2.56 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|