C32H33N5O5 — CID 176698876
N-[5-(1H-benzimidazol-2-yl)-5-[(4-phenylbenzoyl)amino]pentyl]-5-nitrofuran-2-carboxamide;ethane (PubChem CID 176698876) has the molecular formula C32H33N5O5 and a molecular weight of 567.65 g/mol. Its IUPAC name is N-[5-(1H-benzimidazol-2-yl)-5-[(4-phenylbenzoyl)amino]pentyl]-5-nitrofuran-2-carboxamide;ethane.
| Compound Name | N-[5-(1H-benzimidazol-2-yl)-5-[(4-phenylbenzoyl)amino]pentyl]-5-nitrofuran-2-carboxamide;ethane |
|---|---|
| PubChem CID | 176698876 |
| Molecular Formula | C32H33N5O5 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | N-[5-(1H-benzimidazol-2-yl)-5-[(4-phenylbenzoyl)amino]pentyl]-5-nitrofuran-2-carboxamide;ethane |
| SMILES | CC.O=C(NC(CCCCNC(=O)c1ccc([N+](=O)[O-])o1)c1nc2ccccc2[nH]1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27N5O5.C2H6/c36-29(22-15-13-21(14-16-22)20-8-2-1-3-9-20)34-25(28-32-23-10-4-5-11-24(23)33-28)12-6-7-19-31-30(37)26-17-18-27(40-26)35(38)39;1-2/h1-5,8-11,13-18,25H,6-7,12,19H2,(H,31,37)(H,32,33)(H,34,36);1-2H3 |
| InChIKey | RUMFAXGKPLMPTH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|