C27H27N5O — CID 176698881
N-[4-(1-aminoprop-2-enylideneamino)-1-(1H-benzimidazol-2-yl)butyl]-4-phenylbenzamide (PubChem CID 176698881) has the molecular formula C27H27N5O and a molecular weight of 437.55 g/mol. Its IUPAC name is N-[4-(1-aminoprop-2-enylideneamino)-1-(1H-benzimidazol-2-yl)butyl]-4-phenylbenzamide.
| Compound Name | N-[4-(1-aminoprop-2-enylideneamino)-1-(1H-benzimidazol-2-yl)butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 176698881 |
| Molecular Formula | C27H27N5O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[4-(1-aminoprop-2-enylideneamino)-1-(1H-benzimidazol-2-yl)butyl]-4-phenylbenzamide |
| SMILES | C=C/C(N)=N\CCCC(NC(=O)c1ccc(-c2ccccc2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H27N5O/c1-2-25(28)29-18-8-13-24(26-30-22-11-6-7-12-23(22)31-26)32-27(33)21-16-14-20(15-17-21)19-9-4-3-5-10-19/h2-7,9-12,14-17,24H,1,8,13,18H2,(H2,28,29)(H,30,31)(H,32,33) |
| InChIKey | SOHNAVNPQVXBAC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|