C27H26ClN5O3 — CID 134580713
2-[[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]carbamoyl]-5-phenylbenzoic acid (PubChem CID 134580713) has the molecular formula C27H26ClN5O3 and a molecular weight of 503.99 g/mol. Its IUPAC name is 2-[[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]carbamoyl]-5-phenylbenzoic acid.
| Compound Name | 2-[[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]carbamoyl]-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 134580713 |
| Molecular Formula | C27H26ClN5O3 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-[[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]carbamoyl]-5-phenylbenzoic acid |
| SMILES | N/C(CCl)=N/CCCC(NC(=O)c1ccc(-c2ccccc2)cc1C(=O)O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H26ClN5O3/c28-16-24(29)30-14-6-11-23(25-31-21-9-4-5-10-22(21)32-25)33-26(34)19-13-12-18(15-20(19)27(35)36)17-7-2-1-3-8-17/h1-5,7-10,12-13,15,23H,6,11,14,16H2,(H2,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | MDUFXHLXFPIXPH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|