C29H30FN5O3 — CID 134580822
2-[[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethylbenzimidazol-2-yl)butyl]carbamoyl]-4-phenylbenzoic acid (PubChem CID 134580822) has the molecular formula C29H30FN5O3 and a molecular weight of 515.59 g/mol. Its IUPAC name is 2-[[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethylbenzimidazol-2-yl)butyl]carbamoyl]-4-phenylbenzoic acid.
| Compound Name | 2-[[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethylbenzimidazol-2-yl)butyl]carbamoyl]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 134580822 |
| Molecular Formula | C29H30FN5O3 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethylbenzimidazol-2-yl)butyl]carbamoyl]-4-phenylbenzoic acid |
| SMILES | CCn1c([C@H](CCC/N=C(/N)CF)NC(=O)c2cc(-c3ccccc3)ccc2C(=O)O)nc2ccccc21 |
| InChI | InChI=1S/C29H30FN5O3/c1-2-35-25-13-7-6-11-23(25)33-27(35)24(12-8-16-32-26(31)18-30)34-28(36)22-17-20(14-15-21(22)29(37)38)19-9-4-3-5-10-19/h3-7,9-11,13-15,17,24H,2,8,12,16,18H2,1H3,(H2,31,32)(H,34,36)(H,37,38)/t24-/m0/s1 |
| InChIKey | CNJBVPLWYYYJIA-DEOSSOPVSA-N |
| XLogP | 5.00 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|