C24H27FN6O3 — CID 134580790
N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-methoxy-1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide (PubChem CID 134580790) has the molecular formula C24H27FN6O3 and a molecular weight of 466.52 g/mol. Its IUPAC name is N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-methoxy-1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide.
| Compound Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-methoxy-1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 134580790 |
| Molecular Formula | C24H27FN6O3 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-methoxy-1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
| SMILES | COc1ccc2c(c1)nc([C@H](CCC/N=C(/N)CF)NC(=O)c1cccc3c1C(=O)NC3)n2C |
| InChI | InChI=1S/C24H27FN6O3/c1-31-19-9-8-15(34-2)11-18(19)29-22(31)17(7-4-10-27-20(26)12-25)30-23(32)16-6-3-5-14-13-28-24(33)21(14)16/h3,5-6,8-9,11,17H,4,7,10,12-13H2,1-2H3,(H2,26,27)(H,28,33)(H,30,32)/t17-/m0/s1 |
| InChIKey | KFIKEYZGNDJFAU-KRWDZBQOSA-N |
| XLogP | 2.40 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|