C26H30ClN5O3 — CID 165068330
N-[(1S)-7-chloro-1-(1-ethyl-4-methoxybenzimidazol-2-yl)-6-iminoheptyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide (PubChem CID 165068330) has the molecular formula C26H30ClN5O3 and a molecular weight of 496.01 g/mol. Its IUPAC name is N-[(1S)-7-chloro-1-(1-ethyl-4-methoxybenzimidazol-2-yl)-6-iminoheptyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide.
| Compound Name | N-[(1S)-7-chloro-1-(1-ethyl-4-methoxybenzimidazol-2-yl)-6-iminoheptyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 165068330 |
| Molecular Formula | C26H30ClN5O3 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[(1S)-7-chloro-1-(1-ethyl-4-methoxybenzimidazol-2-yl)-6-iminoheptyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
| SMILES | [H]/N=C(\CCl)CCCC[C@H](NC(=O)c1cccc2c1C(=O)NC2)c1nc2c(OC)cccc2n1CC |
| InChI | InChI=1S/C26H30ClN5O3/c1-3-32-20-12-7-13-21(35-2)23(20)31-24(32)19(11-5-4-9-17(28)14-27)30-25(33)18-10-6-8-16-15-29-26(34)22(16)18/h6-8,10,12-13,19,28H,3-5,9,11,14-15H2,1-2H3,(H,29,34)(H,30,33)/b28-17-/t19-/m0/s1 |
| InChIKey | SIJOAMOYIBCMFW-JTOGBTRBSA-N |
| XLogP | 4.60 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|