C24H27ClN4O4 — CID 159476180
2-[[(1S)-7-chloro-6-imino-1-(4-methoxy-1-methylbenzimidazol-2-yl)heptyl]carbamoyl]benzoic acid (PubChem CID 159476180) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 2-[[(1S)-7-chloro-6-imino-1-(4-methoxy-1-methylbenzimidazol-2-yl)heptyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(1S)-7-chloro-6-imino-1-(4-methoxy-1-methylbenzimidazol-2-yl)heptyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 159476180 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[[(1S)-7-chloro-6-imino-1-(4-methoxy-1-methylbenzimidazol-2-yl)heptyl]carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\CCl)CCCC[C@H](NC(=O)c1ccccc1C(=O)O)c1nc2c(OC)cccc2n1C |
| InChI | InChI=1S/C24H27ClN4O4/c1-29-19-12-7-13-20(33-2)21(19)28-22(29)18(11-6-3-8-15(26)14-25)27-23(30)16-9-4-5-10-17(16)24(31)32/h4-5,7,9-10,12-13,18,26H,3,6,8,11,14H2,1-2H3,(H,27,30)(H,31,32)/b26-15-/t18-/m0/s1 |
| InChIKey | LWKHHEONOMTYHP-OMTSMLQXSA-N |
| XLogP | 4.57 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|