C27H33FN6O3 — CID 134580730
N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethyl-4-methoxybenzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 134580730) has the molecular formula C27H33FN6O3 and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethyl-4-methoxybenzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethyl-4-methoxybenzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 134580730 |
| Molecular Formula | C27H33FN6O3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(1-ethyl-4-methoxybenzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | CCN1Cc2cccc(C(=O)NC(CCC/N=C(/N)CF)c3nc4c(OC)cccc4n3CC)c2C1=O |
| InChI | InChI=1S/C27H33FN6O3/c1-4-33-16-17-9-6-10-18(23(17)27(33)36)26(35)31-19(11-8-14-30-22(29)15-28)25-32-24-20(34(25)5-2)12-7-13-21(24)37-3/h6-7,9-10,12-13,19H,4-5,8,11,14-16H2,1-3H3,(H2,29,30)(H,31,35) |
| InChIKey | VCSPBUYGNLTNMS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|