C23H26FN5O2 — CID 170342277
N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(5-phenyl-1H-imidazol-2-yl)butyl]-2-methoxybenzamide (PubChem CID 170342277) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(5-phenyl-1H-imidazol-2-yl)butyl]-2-methoxybenzamide.
| Compound Name | N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(5-phenyl-1H-imidazol-2-yl)butyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 170342277 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[4-[(1-amino-2-fluoroethylidene)amino]-1-(5-phenyl-1H-imidazol-2-yl)butyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(CCC/N=C(/N)CF)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H26FN5O2/c1-31-20-12-6-5-10-17(20)23(30)29-18(11-7-13-26-21(25)14-24)22-27-15-19(28-22)16-8-3-2-4-9-16/h2-6,8-10,12,15,18H,7,11,13-14H2,1H3,(H2,25,26)(H,27,28)(H,29,30) |
| InChIKey | UBHGYFKYOFCHSN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|