C29H33FN4O3 — CID 174218699
N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(3-methylphenyl)methylamino]-1-oxopentan-2-yl]-2-methoxy-5-phenylbenzamide (PubChem CID 174218699) has the molecular formula C29H33FN4O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(3-methylphenyl)methylamino]-1-oxopentan-2-yl]-2-methoxy-5-phenylbenzamide.
| Compound Name | N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(3-methylphenyl)methylamino]-1-oxopentan-2-yl]-2-methoxy-5-phenylbenzamide |
|---|---|
| PubChem CID | 174218699 |
| Molecular Formula | C29H33FN4O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(3-methylphenyl)methylamino]-1-oxopentan-2-yl]-2-methoxy-5-phenylbenzamide |
| SMILES | COc1ccc(-c2ccccc2)cc1C(=O)NC(CCC/N=C(/N)CF)C(=O)NCc1cccc(C)c1 |
| InChI | InChI=1S/C29H33FN4O3/c1-20-8-6-9-21(16-20)19-33-29(36)25(12-7-15-32-27(31)18-30)34-28(35)24-17-23(13-14-26(24)37-2)22-10-4-3-5-11-22/h3-6,8-11,13-14,16-17,25H,7,12,15,18-19H2,1-2H3,(H2,31,32)(H,33,36)(H,34,35) |
| InChIKey | RETHZAYPYWTVMM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|