C27H30ClFN4O4 — CID 174218703
N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide (PubChem CID 174218703) has the molecular formula C27H30ClFN4O4 and a molecular weight of 529.01 g/mol. Its IUPAC name is N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide.
| Compound Name | N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 174218703 |
| Molecular Formula | C27H30ClFN4O4 |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | N-[5-[(1-amino-2-fluoroethylidene)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2c(OC)cccc2cc1C(=O)NC(CCC/N=C(/N)CF)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H30ClFN4O4/c1-36-23-7-3-5-18-13-21(24(37-2)14-20(18)23)26(34)33-22(6-4-12-31-25(30)15-29)27(35)32-16-17-8-10-19(28)11-9-17/h3,5,7-11,13-14,22H,4,6,12,15-16H2,1-2H3,(H2,30,31)(H,32,35)(H,33,34) |
| InChIKey | VYEQVJHFWSFAFJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|