C25H30FN3O4 — CID 167000453
N'-[(4R)-7-(3,5-dimethoxynaphthalen-2-yl)-4-(5-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-2-fluoroethanimidamide (PubChem CID 167000453) has the molecular formula C25H30FN3O4 and a molecular weight of 455.53 g/mol. Its IUPAC name is N'-[(4R)-7-(3,5-dimethoxynaphthalen-2-yl)-4-(5-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-2-fluoroethanimidamide.
| Compound Name | N'-[(4R)-7-(3,5-dimethoxynaphthalen-2-yl)-4-(5-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-2-fluoroethanimidamide |
|---|---|
| PubChem CID | 167000453 |
| Molecular Formula | C25H30FN3O4 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N'-[(4R)-7-(3,5-dimethoxynaphthalen-2-yl)-4-(5-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-2-fluoroethanimidamide |
| SMILES | COc1cc2c(OC)cccc2cc1C(=O)CC[C@@H](CCC/N=C(/N)CF)c1ncc(C)o1 |
| InChI | InChI=1S/C25H30FN3O4/c1-16-15-29-25(33-16)17(7-5-11-28-24(27)14-26)9-10-21(30)20-12-18-6-4-8-22(31-2)19(18)13-23(20)32-3/h4,6,8,12-13,15,17H,5,7,9-11,14H2,1-3H3,(H2,27,28)/t17-/m1/s1 |
| InChIKey | YHFCLBGXMQXOSL-QGZVFWFLSA-N |
| XLogP | 5.01 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|