C27H32ClFN4O4 — CID 167167201
N-[(2S)-5-[(1-amino-2-fluoroethyl)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide (PubChem CID 167167201) has the molecular formula C27H32ClFN4O4 and a molecular weight of 531.03 g/mol. Its IUPAC name is N-[(2S)-5-[(1-amino-2-fluoroethyl)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide.
| Compound Name | N-[(2S)-5-[(1-amino-2-fluoroethyl)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 167167201 |
| Molecular Formula | C27H32ClFN4O4 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(2S)-5-[(1-amino-2-fluoroethyl)amino]-1-[(4-chlorophenyl)methylamino]-1-oxopentan-2-yl]-3,5-dimethoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2c(OC)cccc2cc1C(=O)N[C@@H](CCCNC(N)CF)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H32ClFN4O4/c1-36-23-7-3-5-18-13-21(24(37-2)14-20(18)23)26(34)33-22(6-4-12-31-25(30)15-29)27(35)32-16-17-8-10-19(28)11-9-17/h3,5,7-11,13-14,22,25,31H,4,6,12,15-16,30H2,1-2H3,(H,32,35)(H,33,34)/t22-,25?/m0/s1 |
| InChIKey | JTSLRMUSTFBSOX-XADRRFQNSA-N |
| XLogP | 3.55 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|