C26H28ClN3O2 — CID 118411664
N-[6-amino-1-[(4-chlorophenyl)methylamino]-1-oxohexan-2-yl]-4-phenylbenzamide (PubChem CID 118411664) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is N-[6-amino-1-[(4-chlorophenyl)methylamino]-1-oxohexan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[6-amino-1-[(4-chlorophenyl)methylamino]-1-oxohexan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 118411664 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[6-amino-1-[(4-chlorophenyl)methylamino]-1-oxohexan-2-yl]-4-phenylbenzamide |
| SMILES | NCCCCC(NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28ClN3O2/c27-23-15-9-19(10-16-23)18-29-26(32)24(8-4-5-17-28)30-25(31)22-13-11-21(12-14-22)20-6-2-1-3-7-20/h1-3,6-7,9-16,24H,4-5,8,17-18,28H2,(H,29,32)(H,30,31) |
| InChIKey | SHODIDFIVOBMAP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|